About benzene-1,3,5-triol;hydrate
benzene-1,3,5-triol;hydrate (PubChem CID 53233771) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is benzene-1,3,5-triol;hydrate.
Molecular Properties
| Compound Name | benzene-1,3,5-triol;hydrate |
| PubChem CID | 53233771 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | benzene-1,3,5-triol;hydrate |
| SMILES | O.Oc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C6H6O3.H2O/c7-4-1-5(8)3-6(9)2-4;/h1-3,7-9H;1H2 |
| InChIKey | JPLWLTSPJLPUQK-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene-1,3,5-triol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3,5-triol;hydrate?
The IUPAC name of benzene-1,3,5-triol;hydrate (CID 53233771) is benzene-1,3,5-triol;hydrate.
What is the SMILES notation for benzene-1,3,5-triol;hydrate?
The canonical SMILES for benzene-1,3,5-triol;hydrate is O.Oc1cc(O)cc(O)c1.
What is the InChIKey of benzene-1,3,5-triol;hydrate?
The InChIKey is JPLWLTSPJLPUQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3.H2O/c7-4-1-5(8)3-6(9)2-4;/h1-3,7-9H;1H2.
What are the key properties of benzene-1,3,5-triol;hydrate?
benzene-1,3,5-triol;hydrate has a molecular weight of 144.13 g/mol, XLogP of -0.02, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3,5-triol;hydrate is sourced from PubChem (CID 53233771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).