C22H34N4O4S — CID 5323381
N-[4-[[4-(4-ethylpiperazine-1-carbonyl)cyclohexyl]methylsulfamoyl]phenyl]acetamide (PubChem CID 5323381) has the molecular formula C22H34N4O4S and a molecular weight of 450.61 g/mol. Its IUPAC name is N-[4-[[4-(4-ethylpiperazine-1-carbonyl)cyclohexyl]methylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-(4-ethylpiperazine-1-carbonyl)cyclohexyl]methylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 5323381 |
| Molecular Formula | C22H34N4O4S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-[4-[[4-(4-ethylpiperazine-1-carbonyl)cyclohexyl]methylsulfamoyl]phenyl]acetamide |
| SMILES | CCN1CCN(C(=O)C2CCC(CNS(=O)(=O)c3ccc(NC(C)=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H34N4O4S/c1-3-25-12-14-26(15-13-25)22(28)19-6-4-18(5-7-19)16-23-31(29,30)21-10-8-20(9-11-21)24-17(2)27/h8-11,18-19,23H,3-7,12-16H2,1-2H3,(H,24,27) |
| InChIKey | TVLIYFMRXFOEON-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |