C35H47N5O4 — CID 53234552
(2S,4S)-4-[benzyl(formyl)amino]-1-[(2S)-2-cyclohexyl-2-[[(2S)-2-(methylamino)propanoyl]amino]acetyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide (PubChem CID 53234552) has the molecular formula C35H47N5O4 and a molecular weight of 601.79 g/mol. Its IUPAC name is (2S,4S)-4-[benzyl(formyl)amino]-1-[(2S)-2-cyclohexyl-2-[[(2S)-2-(methylamino)propanoyl]amino]acetyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-[benzyl(formyl)amino]-1-[(2S)-2-cyclohexyl-2-[[(2S)-2-(methylamino)propanoyl]amino]acetyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 53234552 |
| Molecular Formula | C35H47N5O4 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | (2S,4S)-4-[benzyl(formyl)amino]-1-[(2S)-2-cyclohexyl-2-[[(2S)-2-(methylamino)propanoyl]amino]acetyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide |
| SMILES | CN[C@@H](C)C(=O)N[C@H](C(=O)N1C[C@@H](N(C=O)Cc2ccccc2)C[C@H]1C(=O)N[C@@H]1CCCc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C35H47N5O4/c1-24(36-2)33(42)38-32(27-15-7-4-8-16-27)35(44)40-22-28(39(23-41)21-25-12-5-3-6-13-25)20-31(40)34(43)37-30-19-11-17-26-14-9-10-18-29(26)30/h3,5-6,9-10,12-14,18,23-24,27-28,30-32,36H,4,7-8,11,15-17,19-22H2,1-2H3,(H,37,43)(H,38,42)/t24-,28-,30+,31-,32-/m0/s1 |
| InChIKey | VRPDPALFQCHLDB-RIVRHJBRSA-N |
| XLogP | 3.48 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|