C26H36N2O6 — CID 53234649
(3Z,5E,9E,11E,13E,15Z,17E)-8-(3-amino-4,5-dihydroxyoxan-2-yl)oxy-7-hydroxy-7,19-dimethyl-1-azacycloicosa-3,5,9,11,13,15,17-heptaen-2-one (PubChem CID 53234649) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is (3Z,5E,9E,11E,13E,15Z,17E)-8-(3-amino-4,5-dihydroxyoxan-2-yl)oxy-7-hydroxy-7,19-dimethyl-1-azacycloicosa-3,5,9,11,13,15,17-heptaen-2-one.
| Compound Name | (3Z,5E,9E,11E,13E,15Z,17E)-8-(3-amino-4,5-dihydroxyoxan-2-yl)oxy-7-hydroxy-7,19-dimethyl-1-azacycloicosa-3,5,9,11,13,15,17-heptaen-2-one |
|---|---|
| PubChem CID | 53234649 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (3Z,5E,9E,11E,13E,15Z,17E)-8-(3-amino-4,5-dihydroxyoxan-2-yl)oxy-7-hydroxy-7,19-dimethyl-1-azacycloicosa-3,5,9,11,13,15,17-heptaen-2-one |
| SMILES | CC1/C=C/C=C\C=C\C=C\C=C\C(OC2OCC(O)C(O)C2N)C(C)(O)/C=C/C=C\C(=O)NC1 |
| InChI | InChI=1S/C26H36N2O6/c1-19-13-9-7-5-3-4-6-8-10-14-21(34-25-23(27)24(31)20(29)18-33-25)26(2,32)16-12-11-15-22(30)28-17-19/h3-16,19-21,23-25,29,31-32H,17-18,27H2,1-2H3,(H,28,30)/b4-3+,7-5-,8-6+,13-9+,14-10+,15-11-,16-12+ |
| InChIKey | QAYDTFSWPPJOQZ-UFKQPCJMSA-N |
| XLogP | 1.19 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |