C23H32N2O — CID 53234756
2-[[(1R,2R)-2-amino-1,2-diphenylethyl]amino]cyclononan-1-ol (PubChem CID 53234756) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-amino-1,2-diphenylethyl]amino]cyclononan-1-ol.
| Compound Name | 2-[[(1R,2R)-2-amino-1,2-diphenylethyl]amino]cyclononan-1-ol |
|---|---|
| PubChem CID | 53234756 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 2-[[(1R,2R)-2-amino-1,2-diphenylethyl]amino]cyclononan-1-ol |
| SMILES | N[C@H](c1ccccc1)[C@H](NC1CCCCCCCC1O)c1ccccc1 |
| InChI | InChI=1S/C23H32N2O/c24-22(18-12-6-4-7-13-18)23(19-14-8-5-9-15-19)25-20-16-10-2-1-3-11-17-21(20)26/h4-9,12-15,20-23,25-26H,1-3,10-11,16-17,24H2/t20?,21?,22-,23-/m1/s1 |
| InChIKey | MUXKOYVZLZXTAQ-BWWMBTDCSA-N |
| XLogP | 4.49 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |