C22H36N2O4S — CID 5323478
N-(3-ethoxypropyl)-4-[[(2,4,6-trimethylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxamide (PubChem CID 5323478) has the molecular formula C22H36N2O4S and a molecular weight of 424.61 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4-[[(2,4,6-trimethylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-4-[[(2,4,6-trimethylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 5323478 |
| Molecular Formula | C22H36N2O4S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | N-(3-ethoxypropyl)-4-[[(2,4,6-trimethylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCC(CNS(=O)(=O)c2c(C)cc(C)cc2C)CC1 |
| InChI | InChI=1S/C22H36N2O4S/c1-5-28-12-6-11-23-22(25)20-9-7-19(8-10-20)15-24-29(26,27)21-17(3)13-16(2)14-18(21)4/h13-14,19-20,24H,5-12,15H2,1-4H3,(H,23,25) |
| InChIKey | IQGNSICGNFAJCT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|