About (E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine
(E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine (PubChem CID 53234790) has the molecular formula C17H20N4O5
and a molecular weight of 360.37 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine |
| PubChem CID | 53234790 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine |
| SMILES | COc1cnc(-c2ccccn2)nc1NC(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H16N4O.C4H4O4/c1-9(2)16-13-11(18-3)8-15-12(17-13)10-6-4-5-7-14-10;5-3(6)1-2-4(7)8/h4-9H,1-3H3,(H,15,16,17);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ZHJZIJUHYRZUPK-WLHGVMLRSA-N |
| XLogP | 2.08 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine?
The IUPAC name of (E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine (CID 53234790) is (E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine.
What is the SMILES notation for (E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine?
The canonical SMILES for (E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine is COc1cnc(-c2ccccn2)nc1NC(C)C.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine?
The InChIKey is ZHJZIJUHYRZUPK-WLHGVMLRSA-N. The full InChI is InChI=1S/C13H16N4O.C4H4O4/c1-9(2)16-13-11(18-3)8-15-12(17-13)10-6-4-5-7-14-10;5-3(6)1-2-4(7)8/h4-9H,1-3H3,(H,15,16,17);1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine?
(E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine has a molecular weight of 360.37 g/mol, XLogP of 2.08, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;5-methoxy-N-propan-2-yl-2-pyridin-2-ylpyrimidin-4-amine is sourced from PubChem (CID 53234790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).