C52H54CaN4O8 — CID 53234832
calcium bis((E,3R,5S)-7-[2-cyclopropyl-4-(N-methylanilino)quinolin-3-yl]-3,5-dihydroxyhept-6-enoate) (PubChem CID 53234832) has the molecular formula C52H54CaN4O8 and a molecular weight of 903.10 g/mol. Its IUPAC name is calcium bis((E,3R,5S)-7-[2-cyclopropyl-4-(N-methylanilino)quinolin-3-yl]-3,5-dihydroxyhept-6-enoate).
| Compound Name | calcium bis((E,3R,5S)-7-[2-cyclopropyl-4-(N-methylanilino)quinolin-3-yl]-3,5-dihydroxyhept-6-enoate) |
|---|---|
| PubChem CID | 53234832 |
| Molecular Formula | C52H54CaN4O8 |
| Molecular Weight | 903.10 g/mol |
| Exact Mass | 902.36 |
| IUPAC Name | calcium bis((E,3R,5S)-7-[2-cyclopropyl-4-(N-methylanilino)quinolin-3-yl]-3,5-dihydroxyhept-6-enoate) |
| SMILES | CN(c1ccccc1)c1c(/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])c(C2CC2)nc2ccccc12.CN(c1ccccc1)c1c(/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])c(C2CC2)nc2ccccc12.[Ca+2] |
| InChI | InChI=1S/2C26H28N2O4.Ca/c2*1-28(18-7-3-2-4-8-18)26-21-9-5-6-10-23(21)27-25(17-11-12-17)22(26)14-13-19(29)15-20(30)16-24(31)32;/h2*2-10,13-14,17,19-20,29-30H,11-12,15-16H2,1H3,(H,31,32);/q;;+2/p-2/b2*14-13+;/t2*19-,20-;/m11./s1 |
| InChIKey | FVSNEUXPHXXHCV-XTQDQIAPSA-L |
| XLogP | 5.91 |
| TPSA | 193.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.10 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |