C15H18N4O — CID 53234870
N-cyclopentyl-5-methoxy-2-pyridin-2-ylpyrimidin-4-amine (PubChem CID 53234870) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is N-cyclopentyl-5-methoxy-2-pyridin-2-ylpyrimidin-4-amine.
| Compound Name | N-cyclopentyl-5-methoxy-2-pyridin-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 53234870 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-cyclopentyl-5-methoxy-2-pyridin-2-ylpyrimidin-4-amine |
| SMILES | COc1cnc(-c2ccccn2)nc1NC1CCCC1 |
| InChI | InChI=1S/C15H18N4O/c1-20-13-10-17-14(12-8-4-5-9-16-12)19-15(13)18-11-6-2-3-7-11/h4-5,8-11H,2-3,6-7H2,1H3,(H,17,18,19) |
| InChIKey | UBYMOIDLLUDNKT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |