C15H21NO6 — CID 53234987
2-[(1S,5R,6R)-6-[[[(1S)-1-acetyloxyethoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (PubChem CID 53234987) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is 2-[(1S,5R,6R)-6-[[[(1S)-1-acetyloxyethoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid.
| Compound Name | 2-[(1S,5R,6R)-6-[[[(1S)-1-acetyloxyethoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
|---|---|
| PubChem CID | 53234987 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-[(1S,5R,6R)-6-[[[(1S)-1-acetyloxyethoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
| SMILES | CC(=O)O[C@H](C)OC(=O)NC[C@@]1(CC(=O)O)C[C@@H]2CC=C[C@@H]21 |
| InChI | InChI=1S/C15H21NO6/c1-9(17)21-10(2)22-14(20)16-8-15(7-13(18)19)6-11-4-3-5-12(11)15/h3,5,10-12H,4,6-8H2,1-2H3,(H,16,20)(H,18,19)/t10-,11-,12-,15-/m0/s1 |
| InChIKey | HNHIPHHQDXTSEK-ASHKBJFXSA-N |
| XLogP | 1.68 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|