C16H23NO6 — CID 53234988
2-[(1S,5R,6R)-6-[[[(1R)-1-propanoyloxyethoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (PubChem CID 53234988) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-[(1S,5R,6R)-6-[[[(1R)-1-propanoyloxyethoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid.
| Compound Name | 2-[(1S,5R,6R)-6-[[[(1R)-1-propanoyloxyethoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
|---|---|
| PubChem CID | 53234988 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-[(1S,5R,6R)-6-[[[(1R)-1-propanoyloxyethoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
| SMILES | CCC(=O)O[C@@H](C)OC(=O)NC[C@@]1(CC(=O)O)C[C@@H]2CC=C[C@@H]21 |
| InChI | InChI=1S/C16H23NO6/c1-3-14(20)22-10(2)23-15(21)17-9-16(8-13(18)19)7-11-5-4-6-12(11)16/h4,6,10-12H,3,5,7-9H2,1-2H3,(H,17,21)(H,18,19)/t10-,11+,12+,16+/m1/s1 |
| InChIKey | NSUPIJYXZFFRSE-YRORDHRNSA-N |
| XLogP | 2.07 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|