C21H33NO6 — CID 53235071
2-[(1S,5R,6R)-3-ethyl-6-[[[(1R)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (PubChem CID 53235071) has the molecular formula C21H33NO6 and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-[(1S,5R,6R)-3-ethyl-6-[[[(1R)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid.
| Compound Name | 2-[(1S,5R,6R)-3-ethyl-6-[[[(1R)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
|---|---|
| PubChem CID | 53235071 |
| Molecular Formula | C21H33NO6 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 2-[(1S,5R,6R)-3-ethyl-6-[[[(1R)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
| SMILES | CCC1=C[C@H]2[C@@H](C1)C[C@@]2(CNC(=O)O[C@@H](OC(=O)C(C)C)C(C)C)CC(=O)O |
| InChI | InChI=1S/C21H33NO6/c1-6-14-7-15-9-21(10-17(23)24,16(15)8-14)11-22-20(26)28-19(13(4)5)27-18(25)12(2)3/h8,12-13,15-16,19H,6-7,9-11H2,1-5H3,(H,22,26)(H,23,24)/t15-,16-,19+,21-/m0/s1 |
| InChIKey | CDQVDZBSILAFTB-DGCVBNHASA-N |
| XLogP | 3.73 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|