C18H22FN5O2S — CID 53235121
(4S)-4-[2-fluoro-5-[[4-(2-methoxyethoxy)pyrimidin-2-yl]amino]phenyl]-4-methyl-5,6-dihydro-1,3-thiazin-2-amine (PubChem CID 53235121) has the molecular formula C18H22FN5O2S and a molecular weight of 391.47 g/mol. Its IUPAC name is (4S)-4-[2-fluoro-5-[[4-(2-methoxyethoxy)pyrimidin-2-yl]amino]phenyl]-4-methyl-5,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | (4S)-4-[2-fluoro-5-[[4-(2-methoxyethoxy)pyrimidin-2-yl]amino]phenyl]-4-methyl-5,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 53235121 |
| Molecular Formula | C18H22FN5O2S |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (4S)-4-[2-fluoro-5-[[4-(2-methoxyethoxy)pyrimidin-2-yl]amino]phenyl]-4-methyl-5,6-dihydro-1,3-thiazin-2-amine |
| SMILES | COCCOc1ccnc(Nc2ccc(F)c([C@]3(C)CCSC(N)=N3)c2)n1 |
| InChI | InChI=1S/C18H22FN5O2S/c1-18(6-10-27-16(20)24-18)13-11-12(3-4-14(13)19)22-17-21-7-5-15(23-17)26-9-8-25-2/h3-5,7,11H,6,8-10H2,1-2H3,(H2,20,24)(H,21,22,23)/t18-/m0/s1 |
| InChIKey | PHBLJRINDZXAIZ-SFHVURJKSA-N |
| XLogP | 3.05 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|