C21H34O2 — CID 5323525
methyl (2E,5R,10E,12E)-3,5,15-trimethyl-7-methylidenehexadeca-2,10,12-trienoate (PubChem CID 5323525) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is methyl (2E,5R,10E,12E)-3,5,15-trimethyl-7-methylidenehexadeca-2,10,12-trienoate.
| Compound Name | methyl (2E,5R,10E,12E)-3,5,15-trimethyl-7-methylidenehexadeca-2,10,12-trienoate |
|---|---|
| PubChem CID | 5323525 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | methyl (2E,5R,10E,12E)-3,5,15-trimethyl-7-methylidenehexadeca-2,10,12-trienoate |
| SMILES | C=C(CC/C=C/C=C/CC(C)C)C[C@@H](C)C/C(C)=C/C(=O)OC |
| InChI | InChI=1S/C21H34O2/c1-17(2)12-10-8-7-9-11-13-18(3)14-19(4)15-20(5)16-21(22)23-6/h7-10,16-17,19H,3,11-15H2,1-2,4-6H3/b9-7+,10-8+,20-16+/t19-/m1/s1 |
| InChIKey | IHHOSMKJYXHFAB-VLCGKGKVSA-N |
| XLogP | 6.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|