C14H24F8O4Si — CID 53235631
triethoxy-[3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]silane (PubChem CID 53235631) has the molecular formula C14H24F8O4Si and a molecular weight of 436.41 g/mol. Its IUPAC name is triethoxy-[3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]silane.
| Compound Name | triethoxy-[3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]silane |
|---|---|
| PubChem CID | 53235631 |
| Molecular Formula | C14H24F8O4Si |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | triethoxy-[3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]silane |
| SMILES | CCO[Si](CCCOCC(F)(F)C(F)(F)C(F)(F)C(F)F)(OCC)OCC |
| InChI | InChI=1S/C14H24F8O4Si/c1-4-24-27(25-5-2,26-6-3)9-7-8-23-10-12(17,18)14(21,22)13(19,20)11(15)16/h11H,4-10H2,1-3H3 |
| InChIKey | GKHGWQFAJUGVNT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|