C25H27IN2O2S — CID 53235762
(5Z)-8-(benzenesulfonyl)-3-[(2Z)-2-(iodomethylidene)butyl]-1,2,4,7-tetrahydroazonino[5,4-b]indole (PubChem CID 53235762) has the molecular formula C25H27IN2O2S and a molecular weight of 546.47 g/mol. Its IUPAC name is (5Z)-8-(benzenesulfonyl)-3-[(2Z)-2-(iodomethylidene)butyl]-1,2,4,7-tetrahydroazonino[5,4-b]indole.
| Compound Name | (5Z)-8-(benzenesulfonyl)-3-[(2Z)-2-(iodomethylidene)butyl]-1,2,4,7-tetrahydroazonino[5,4-b]indole |
|---|---|
| PubChem CID | 53235762 |
| Molecular Formula | C25H27IN2O2S |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | (5Z)-8-(benzenesulfonyl)-3-[(2Z)-2-(iodomethylidene)butyl]-1,2,4,7-tetrahydroazonino[5,4-b]indole |
| SMILES | CC/C(=C/I)CN1C/C=C\Cc2c(c3ccccc3n2S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H27IN2O2S/c1-2-20(18-26)19-27-16-9-8-14-25-23(15-17-27)22-12-6-7-13-24(22)28(25)31(29,30)21-10-4-3-5-11-21/h3-13,18H,2,14-17,19H2,1H3/b9-8-,20-18- |
| InChIKey | IXWARPDGNYSSID-AOUOVFQDSA-N |
| XLogP | 5.56 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|