(2S)-3,3-dimethylaziridine-2-carboxylic acid

C5H9NO2 — CID 53235787

IUPAC(2S)-3,3-dimethylaziridine-2-carboxylic acid
SMILESCC1(C)N[C@@H]1C(=O)O
InChIInChI=1S/C5H9NO2/c1-5(2)3(6-5)4(7)8/h3,6H,1-2H3,(H,7,8)/t3-/m1/s1
InChIKeyLQNRQHXPYZSWHH-GSVOUGTGSA-N
MW115.13 g/mol
LogP-0.18
Rot. Bonds1

About (2S)-3,3-dimethylaziridine-2-carboxylic acid

(2S)-3,3-dimethylaziridine-2-carboxylic acid (PubChem CID 53235787) has the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. Its IUPAC name is (2S)-3,3-dimethylaziridine-2-carboxylic acid.

Molecular Properties

Compound Name(2S)-3,3-dimethylaziridine-2-carboxylic acid
PubChem CID53235787
Molecular FormulaC5H9NO2
Molecular Weight115.13 g/mol
Exact Mass115.06
IUPAC Name(2S)-3,3-dimethylaziridine-2-carboxylic acid
SMILESCC1(C)N[C@@H]1C(=O)O
InChIInChI=1S/C5H9NO2/c1-5(2)3(6-5)4(7)8/h3,6H,1-2H3,(H,7,8)/t3-/m1/s1
InChIKeyLQNRQHXPYZSWHH-GSVOUGTGSA-N
XLogP-0.18
TPSA59.24 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500115.13
LogP ≤ 5-0.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze (2S)-3,3-dimethylaziridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-3,3-dimethylaziridine-2-carboxylic acid?
The IUPAC name of (2S)-3,3-dimethylaziridine-2-carboxylic acid (CID 53235787) is (2S)-3,3-dimethylaziridine-2-carboxylic acid.
What is the SMILES notation for (2S)-3,3-dimethylaziridine-2-carboxylic acid?
The canonical SMILES for (2S)-3,3-dimethylaziridine-2-carboxylic acid is CC1(C)N[C@@H]1C(=O)O.
What is the InChIKey of (2S)-3,3-dimethylaziridine-2-carboxylic acid?
The InChIKey is LQNRQHXPYZSWHH-GSVOUGTGSA-N. The full InChI is InChI=1S/C5H9NO2/c1-5(2)3(6-5)4(7)8/h3,6H,1-2H3,(H,7,8)/t3-/m1/s1.
What are the key properties of (2S)-3,3-dimethylaziridine-2-carboxylic acid?
(2S)-3,3-dimethylaziridine-2-carboxylic acid has a molecular weight of 115.13 g/mol, XLogP of -0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,3-dimethylaziridine-2-carboxylic acid is sourced from PubChem (CID 53235787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).