About (2S)-3,3-dimethylaziridine-2-carboxylic acid
(2S)-3,3-dimethylaziridine-2-carboxylic acid (PubChem CID 53235787) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is (2S)-3,3-dimethylaziridine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-3,3-dimethylaziridine-2-carboxylic acid |
| PubChem CID | 53235787 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | (2S)-3,3-dimethylaziridine-2-carboxylic acid |
| SMILES | CC1(C)N[C@@H]1C(=O)O |
| InChI | InChI=1S/C5H9NO2/c1-5(2)3(6-5)4(7)8/h3,6H,1-2H3,(H,7,8)/t3-/m1/s1 |
| InChIKey | LQNRQHXPYZSWHH-GSVOUGTGSA-N |
| XLogP | -0.18 |
| TPSA | 59.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3,3-dimethylaziridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,3-dimethylaziridine-2-carboxylic acid?
The IUPAC name of (2S)-3,3-dimethylaziridine-2-carboxylic acid (CID 53235787) is (2S)-3,3-dimethylaziridine-2-carboxylic acid.
What is the SMILES notation for (2S)-3,3-dimethylaziridine-2-carboxylic acid?
The canonical SMILES for (2S)-3,3-dimethylaziridine-2-carboxylic acid is CC1(C)N[C@@H]1C(=O)O.
What is the InChIKey of (2S)-3,3-dimethylaziridine-2-carboxylic acid?
The InChIKey is LQNRQHXPYZSWHH-GSVOUGTGSA-N. The full InChI is InChI=1S/C5H9NO2/c1-5(2)3(6-5)4(7)8/h3,6H,1-2H3,(H,7,8)/t3-/m1/s1.
What are the key properties of (2S)-3,3-dimethylaziridine-2-carboxylic acid?
(2S)-3,3-dimethylaziridine-2-carboxylic acid has a molecular weight of 115.13 g/mol, XLogP of -0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,3-dimethylaziridine-2-carboxylic acid is sourced from PubChem (CID 53235787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).