C33H54O4Si2 — CID 53235836
(3S,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-2,2,6-trimethyl-3-triethylsilyloxyheptanal (PubChem CID 53235836) has the molecular formula C33H54O4Si2 and a molecular weight of 570.96 g/mol. Its IUPAC name is (3S,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-2,2,6-trimethyl-3-triethylsilyloxyheptanal.
| Compound Name | (3S,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-2,2,6-trimethyl-3-triethylsilyloxyheptanal |
|---|---|
| PubChem CID | 53235836 |
| Molecular Formula | C33H54O4Si2 |
| Molecular Weight | 570.96 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | (3S,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-2,2,6-trimethyl-3-triethylsilyloxyheptanal |
| SMILES | CC[Si](CC)(CC)O[C@@H](C[C@H](OC)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)(C)C=O |
| InChI | InChI=1S/C33H54O4Si2/c1-11-38(12-2,13-3)37-31(33(8,9)26-34)24-30(35-10)27(4)25-36-39(32(5,6)7,28-20-16-14-17-21-28)29-22-18-15-19-23-29/h14-23,26-27,30-31H,11-13,24-25H2,1-10H3/t27-,30-,31-/m0/s1 |
| InChIKey | JZXPFZPSJRVURS-NAYUSWPISA-N |
| XLogP | 7.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.96 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|