C15H28O3 — CID 53235916
(4S)-4-[(2S,3S)-2-methoxy-3-methylpent-4-enyl]-2,2,5,5-tetramethyl-1,3-dioxane (PubChem CID 53235916) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (4S)-4-[(2S,3S)-2-methoxy-3-methylpent-4-enyl]-2,2,5,5-tetramethyl-1,3-dioxane.
| Compound Name | (4S)-4-[(2S,3S)-2-methoxy-3-methylpent-4-enyl]-2,2,5,5-tetramethyl-1,3-dioxane |
|---|---|
| PubChem CID | 53235916 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (4S)-4-[(2S,3S)-2-methoxy-3-methylpent-4-enyl]-2,2,5,5-tetramethyl-1,3-dioxane |
| SMILES | C=C[C@H](C)[C@H](C[C@@H]1OC(C)(C)OCC1(C)C)OC |
| InChI | InChI=1S/C15H28O3/c1-8-11(2)12(16-7)9-13-14(3,4)10-17-15(5,6)18-13/h8,11-13H,1,9-10H2,2-7H3/t11-,12-,13-/m0/s1 |
| InChIKey | XROUBQXAEQPECT-AVGNSLFASA-N |
| XLogP | 3.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|