C17H21F13O2 — CID 53235971
ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hexylnonanoate (PubChem CID 53235971) has the molecular formula C17H21F13O2 and a molecular weight of 504.33 g/mol. Its IUPAC name is ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hexylnonanoate.
| Compound Name | ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hexylnonanoate |
|---|---|
| PubChem CID | 53235971 |
| Molecular Formula | C17H21F13O2 |
| Molecular Weight | 504.33 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hexylnonanoate |
| SMILES | CCCCCCC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C17H21F13O2/c1-3-5-6-7-8-10(11(31)32-4-2)9-12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h10H,3-9H2,1-2H3 |
| InChIKey | PHHKVMOPMRGJNG-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.33 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|