C22H44O7Si — CID 53235980
methyl (E,4R,5S,7S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-5,9-bis(methoxymethoxy)-4-methyldec-2-enoate (PubChem CID 53235980) has the molecular formula C22H44O7Si and a molecular weight of 448.67 g/mol. Its IUPAC name is methyl (E,4R,5S,7S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-5,9-bis(methoxymethoxy)-4-methyldec-2-enoate.
| Compound Name | methyl (E,4R,5S,7S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-5,9-bis(methoxymethoxy)-4-methyldec-2-enoate |
|---|---|
| PubChem CID | 53235980 |
| Molecular Formula | C22H44O7Si |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | methyl (E,4R,5S,7S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-5,9-bis(methoxymethoxy)-4-methyldec-2-enoate |
| SMILES | COCO[C@H](C)C[C@@H](C[C@H](OCOC)[C@H](C)/C=C/C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O7Si/c1-17(11-12-21(23)26-8)20(28-16-25-7)14-19(13-18(2)27-15-24-6)29-30(9,10)22(3,4)5/h11-12,17-20H,13-16H2,1-10H3/b12-11+/t17-,18-,19+,20+/m1/s1 |
| InChIKey | FNLINHJZSWCKAD-JWLJNMLQSA-N |
| XLogP | 4.52 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|