C19H18O4 — CID 53236040
bis(prop-2-enyl) 2-methylnaphthalene-1,3-dicarboxylate (PubChem CID 53236040) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-methylnaphthalene-1,3-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 2-methylnaphthalene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 53236040 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | bis(prop-2-enyl) 2-methylnaphthalene-1,3-dicarboxylate |
| SMILES | C=CCOC(=O)c1cc2ccccc2c(C(=O)OCC=C)c1C |
| InChI | InChI=1S/C19H18O4/c1-4-10-22-18(20)16-12-14-8-6-7-9-15(14)17(13(16)3)19(21)23-11-5-2/h4-9,12H,1-2,10-11H2,3H3 |
| InChIKey | VWAHCCVUSSNEJQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|