C29H26Cl2N4O7 — CID 53236050
ethyl 3-(2,6-dichlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-2-[[3-methyl-5-[(E)-2-phenylethenyl]-1,2-oxazol-4-yl]carbamoyl]butanoate (PubChem CID 53236050) has the molecular formula C29H26Cl2N4O7 and a molecular weight of 613.45 g/mol. Its IUPAC name is ethyl 3-(2,6-dichlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-2-[[3-methyl-5-[(E)-2-phenylethenyl]-1,2-oxazol-4-yl]carbamoyl]butanoate.
| Compound Name | ethyl 3-(2,6-dichlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-2-[[3-methyl-5-[(E)-2-phenylethenyl]-1,2-oxazol-4-yl]carbamoyl]butanoate |
|---|---|
| PubChem CID | 53236050 |
| Molecular Formula | C29H26Cl2N4O7 |
| Molecular Weight | 613.45 g/mol |
| Exact Mass | 612.12 |
| IUPAC Name | ethyl 3-(2,6-dichlorophenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-2-[[3-methyl-5-[(E)-2-phenylethenyl]-1,2-oxazol-4-yl]carbamoyl]butanoate |
| SMILES | CCOC(=O)C(C(=O)Nc1c(C)noc1/C=C/c1ccccc1)C(Cc1onc(C)c1[N+](=O)[O-])c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C29H26Cl2N4O7/c1-4-40-29(37)25(28(36)32-26-16(2)33-41-22(26)14-13-18-9-6-5-7-10-18)19(24-20(30)11-8-12-21(24)31)15-23-27(35(38)39)17(3)34-42-23/h5-14,19,25H,4,15H2,1-3H3,(H,32,36)/b14-13+ |
| InChIKey | SJILIDLUBXPIKO-BUHFOSPRSA-N |
| XLogP | 6.81 |
| TPSA | 150.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.45 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|