C20H23Cl2N5O3 — CID 53236117
2-amino-N-cyclobutyl-4-[2,4-dichloro-6-(2-methoxyethoxy)phenyl]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxamide (PubChem CID 53236117) has the molecular formula C20H23Cl2N5O3 and a molecular weight of 452.34 g/mol. Its IUPAC name is 2-amino-N-cyclobutyl-4-[2,4-dichloro-6-(2-methoxyethoxy)phenyl]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxamide.
| Compound Name | 2-amino-N-cyclobutyl-4-[2,4-dichloro-6-(2-methoxyethoxy)phenyl]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 53236117 |
| Molecular Formula | C20H23Cl2N5O3 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 2-amino-N-cyclobutyl-4-[2,4-dichloro-6-(2-methoxyethoxy)phenyl]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxamide |
| SMILES | COCCOc1cc(Cl)cc(Cl)c1-c1nc(N)nc2c1CN(C(=O)NC1CCC1)C2 |
| InChI | InChI=1S/C20H23Cl2N5O3/c1-29-5-6-30-16-8-11(21)7-14(22)17(16)18-13-9-27(10-15(13)25-19(23)26-18)20(28)24-12-3-2-4-12/h7-8,12H,2-6,9-10H2,1H3,(H,24,28)(H2,23,25,26) |
| InChIKey | WZLCFOXGYACZKU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|