About 2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene
2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene (PubChem CID 5323613) has the molecular formula C14H20S2
and a molecular weight of 252.45 g/mol. Its IUPAC name is 2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene.
Molecular Properties
| Compound Name | 2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene |
| PubChem CID | 5323613 |
| Molecular Formula | C14H20S2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene |
| SMILES | C1CCC2=C(CC1)SC1=C(CCCCC1)S2 |
| InChI | InChI=1S/C14H20S2/c1-3-7-11-12(8-4-1)16-14-10-6-2-5-9-13(14)15-11/h1-10H2 |
| InChIKey | HKYYNGHXIMEFAN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene?
The IUPAC name of 2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene (CID 5323613) is 2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene.
What is the SMILES notation for 2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene?
The canonical SMILES for 2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene is C1CCC2=C(CC1)SC1=C(CCCCC1)S2.
What is the InChIKey of 2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene?
The InChIKey is HKYYNGHXIMEFAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20S2/c1-3-7-11-12(8-4-1)16-14-10-6-2-5-9-13(14)15-11/h1-10H2.
What are the key properties of 2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene?
2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene has a molecular weight of 252.45 g/mol, XLogP of 5.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,10-dithiatricyclo[9.5.0.03,9]hexadeca-1(11),3(9)-diene is sourced from PubChem (CID 5323613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).