C18H26N2O3 — CID 53236223
N-[4-[3-[(1R,5R)-6-azabicyclo[3.2.0]heptan-6-yl]propoxy]phenyl]-2-methoxyacetamide (PubChem CID 53236223) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[4-[3-[(1R,5R)-6-azabicyclo[3.2.0]heptan-6-yl]propoxy]phenyl]-2-methoxyacetamide.
| Compound Name | N-[4-[3-[(1R,5R)-6-azabicyclo[3.2.0]heptan-6-yl]propoxy]phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 53236223 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-[4-[3-[(1R,5R)-6-azabicyclo[3.2.0]heptan-6-yl]propoxy]phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(OCCCN2C[C@H]3CCC[C@H]32)cc1 |
| InChI | InChI=1S/C18H26N2O3/c1-22-13-18(21)19-15-6-8-16(9-7-15)23-11-3-10-20-12-14-4-2-5-17(14)20/h6-9,14,17H,2-5,10-13H2,1H3,(H,19,21)/t14-,17-/m1/s1 |
| InChIKey | YBGNKPWFACPLHS-RHSMWYFYSA-N |
| XLogP | 2.52 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|