About 5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole
5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole (PubChem CID 5323624) has the molecular formula C15H12N6
and a molecular weight of 276.30 g/mol. Its IUPAC name is 5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole.
Molecular Properties
| Compound Name | 5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole |
| PubChem CID | 5323624 |
| Molecular Formula | C15H12N6 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole |
| SMILES | c1cc(-c2cc(-c3ccn[nH]3)cc(-c3ccn[nH]3)c2)[nH]n1 |
| InChI | InChI=1S/C15H12N6/c1-4-16-19-13(1)10-7-11(14-2-5-17-20-14)9-12(8-10)15-3-6-18-21-15/h1-9H,(H,16,19)(H,17,20)(H,18,21) |
| InChIKey | YSCPKNKUSVTOGU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole?
The IUPAC name of 5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole (CID 5323624) is 5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole.
What is the SMILES notation for 5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole?
The canonical SMILES for 5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole is c1cc(-c2cc(-c3ccn[nH]3)cc(-c3ccn[nH]3)c2)[nH]n1.
What is the InChIKey of 5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole?
The InChIKey is YSCPKNKUSVTOGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N6/c1-4-16-19-13(1)10-7-11(14-2-5-17-20-14)9-12(8-10)15-3-6-18-21-15/h1-9H,(H,16,19)(H,17,20)(H,18,21).
What are the key properties of 5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole?
5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole has a molecular weight of 276.30 g/mol, XLogP of 2.86, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-bis(1H-pyrazol-5-yl)phenyl]-1H-pyrazole is sourced from PubChem (CID 5323624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).