About (2-chloro-1,3-thiazol-5-yl)methylurea
(2-chloro-1,3-thiazol-5-yl)methylurea (PubChem CID 53236471) has the molecular formula C5H6ClN3OS
and a molecular weight of 191.64 g/mol. Its IUPAC name is (2-chloro-1,3-thiazol-5-yl)methylurea.
Molecular Properties
| Compound Name | (2-chloro-1,3-thiazol-5-yl)methylurea |
| PubChem CID | 53236471 |
| Molecular Formula | C5H6ClN3OS |
| Molecular Weight | 191.64 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | (2-chloro-1,3-thiazol-5-yl)methylurea |
| SMILES | NC(=O)NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C5H6ClN3OS/c6-4-8-1-3(11-4)2-9-5(7)10/h1H,2H2,(H3,7,9,10) |
| InChIKey | JPLZYOZEQJHMHP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.64 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-chloro-1,3-thiazol-5-yl)methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-1,3-thiazol-5-yl)methylurea?
The IUPAC name of (2-chloro-1,3-thiazol-5-yl)methylurea (CID 53236471) is (2-chloro-1,3-thiazol-5-yl)methylurea.
What is the SMILES notation for (2-chloro-1,3-thiazol-5-yl)methylurea?
The canonical SMILES for (2-chloro-1,3-thiazol-5-yl)methylurea is NC(=O)NCc1cnc(Cl)s1.
What is the InChIKey of (2-chloro-1,3-thiazol-5-yl)methylurea?
The InChIKey is JPLZYOZEQJHMHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6ClN3OS/c6-4-8-1-3(11-4)2-9-5(7)10/h1H,2H2,(H3,7,9,10).
What are the key properties of (2-chloro-1,3-thiazol-5-yl)methylurea?
(2-chloro-1,3-thiazol-5-yl)methylurea has a molecular weight of 191.64 g/mol, XLogP of 0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-1,3-thiazol-5-yl)methylurea is sourced from PubChem (CID 53236471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).