C30H24N4O4 — CID 53236559
(2R,5S,8R)-2-(1,3-benzodioxol-5-yl)-5-(1H-indol-3-ylmethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 53236559) has the molecular formula C30H24N4O4 and a molecular weight of 504.55 g/mol. Its IUPAC name is (2R,5S,8R)-2-(1,3-benzodioxol-5-yl)-5-(1H-indol-3-ylmethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,5S,8R)-2-(1,3-benzodioxol-5-yl)-5-(1H-indol-3-ylmethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 53236559 |
| Molecular Formula | C30H24N4O4 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (2R,5S,8R)-2-(1,3-benzodioxol-5-yl)-5-(1H-indol-3-ylmethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | O=C1N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N2[C@H](c3ccc4c(c3)OCO4)c3[nH]c4ccccc4c3C[C@H]12 |
| InChI | InChI=1S/C30H24N4O4/c35-29-24-13-20-19-6-2-4-8-22(19)32-27(20)28(16-9-10-25-26(12-16)38-15-37-25)34(24)30(36)23(33-29)11-17-14-31-21-7-3-1-5-18(17)21/h1-10,12,14,23-24,28,31-32H,11,13,15H2,(H,33,35)/t23-,24+,28+/m0/s1 |
| InChIKey | AOUKHFHMCXSQCZ-VYKTZEHYSA-N |
| XLogP | 3.96 |
| TPSA | 99.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|