C31H30Cl2FN3O4 — CID 53236633
methyl 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]benzoate (PubChem CID 53236633) has the molecular formula C31H30Cl2FN3O4 and a molecular weight of 598.50 g/mol. Its IUPAC name is methyl 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 53236633 |
| Molecular Formula | C31H30Cl2FN3O4 |
| Molecular Weight | 598.50 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | methyl 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)cc1 |
| InChI | InChI=1S/C31H30Cl2FN3O4/c1-30(2,3)15-23-31(20-13-10-17(32)14-22(20)36-29(31)40)24(19-6-5-7-21(33)25(19)34)26(37-23)27(38)35-18-11-8-16(9-12-18)28(39)41-4/h5-14,23-24,26,37H,15H2,1-4H3,(H,35,38)(H,36,40)/t23-,24-,26+,31+/m0/s1 |
| InChIKey | MRXLVOLHGMZGOW-ISKXDESKSA-N |
| XLogP | 6.31 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.50 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |