C22H46O7Si — CID 53236759
(2S,3S,4R,5S,7S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5,9-bis(methoxymethoxy)-2,4-dimethyldecanal (PubChem CID 53236759) has the molecular formula C22H46O7Si and a molecular weight of 450.69 g/mol. Its IUPAC name is (2S,3S,4R,5S,7S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5,9-bis(methoxymethoxy)-2,4-dimethyldecanal.
| Compound Name | (2S,3S,4R,5S,7S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5,9-bis(methoxymethoxy)-2,4-dimethyldecanal |
|---|---|
| PubChem CID | 53236759 |
| Molecular Formula | C22H46O7Si |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | (2S,3S,4R,5S,7S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5,9-bis(methoxymethoxy)-2,4-dimethyldecanal |
| SMILES | COCO[C@H](C)C[C@@H](C[C@H](OCOC)[C@H](C)[C@H](O)C(C)C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O7Si/c1-16(13-23)21(24)18(3)20(28-15-26-8)12-19(11-17(2)27-14-25-7)29-30(9,10)22(4,5)6/h13,16-21,24H,11-12,14-15H2,1-10H3/t16?,17-,18+,19+,20+,21-/m1/s1 |
| InChIKey | TYFDTFFOHWNTGF-FTANHRGLSA-N |
| XLogP | 3.99 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|