C23H25FN4O3 — CID 53236822
N-[3-[3-[(4-fluorophenyl)methyl]-7-hydroxy-6-oxo-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-1-yl]propyl]-N-methylacetamide (PubChem CID 53236822) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is N-[3-[3-[(4-fluorophenyl)methyl]-7-hydroxy-6-oxo-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-1-yl]propyl]-N-methylacetamide.
| Compound Name | N-[3-[3-[(4-fluorophenyl)methyl]-7-hydroxy-6-oxo-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-1-yl]propyl]-N-methylacetamide |
|---|---|
| PubChem CID | 53236822 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-[3-[3-[(4-fluorophenyl)methyl]-7-hydroxy-6-oxo-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-1-yl]propyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)CCCc1cn(Cc2ccc(F)cc2)c2cnc3c(c12)CCN(O)C3=O |
| InChI | InChI=1S/C23H25FN4O3/c1-15(29)26(2)10-3-4-17-14-27(13-16-5-7-18(24)8-6-16)20-12-25-22-19(21(17)20)9-11-28(31)23(22)30/h5-8,12,14,31H,3-4,9-11,13H2,1-2H3 |
| InChIKey | JQLFKDORBLFBHG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|