C25H28FN3O4 — CID 53237038
3-[(4-fluorophenyl)methyl]-7-hydroxy-1-[3-(oxan-4-yloxy)propyl]-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one (PubChem CID 53237038) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-7-hydroxy-1-[3-(oxan-4-yloxy)propyl]-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one.
| Compound Name | 3-[(4-fluorophenyl)methyl]-7-hydroxy-1-[3-(oxan-4-yloxy)propyl]-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one |
|---|---|
| PubChem CID | 53237038 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-7-hydroxy-1-[3-(oxan-4-yloxy)propyl]-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one |
| SMILES | O=C1c2ncc3c(c(CCCOC4CCOCC4)cn3Cc3ccc(F)cc3)c2CCN1O |
| InChI | InChI=1S/C25H28FN3O4/c26-19-5-3-17(4-6-19)15-28-16-18(2-1-11-33-20-8-12-32-13-9-20)23-21-7-10-29(31)25(30)24(21)27-14-22(23)28/h3-6,14,16,20,31H,1-2,7-13,15H2 |
| InChIKey | DVUKUZDOUVXTEW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|