C20H17F4N3O2 — CID 53237040
3-[(4-fluorophenyl)methyl]-7-hydroxy-1-(3,3,3-trifluoropropyl)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one (PubChem CID 53237040) has the molecular formula C20H17F4N3O2 and a molecular weight of 407.37 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-7-hydroxy-1-(3,3,3-trifluoropropyl)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one.
| Compound Name | 3-[(4-fluorophenyl)methyl]-7-hydroxy-1-(3,3,3-trifluoropropyl)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one |
|---|---|
| PubChem CID | 53237040 |
| Molecular Formula | C20H17F4N3O2 |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-7-hydroxy-1-(3,3,3-trifluoropropyl)-8,9-dihydropyrrolo[2,3-c][1,7]naphthyridin-6-one |
| SMILES | O=C1c2ncc3c(c(CCC(F)(F)F)cn3Cc3ccc(F)cc3)c2CCN1O |
| InChI | InChI=1S/C20H17F4N3O2/c21-14-3-1-12(2-4-14)10-26-11-13(5-7-20(22,23)24)17-15-6-8-27(29)19(28)18(15)25-9-16(17)26/h1-4,9,11,29H,5-8,10H2 |
| InChIKey | JADAWWLPTURLLV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|