About (4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one
(4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one (PubChem CID 53237455) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is (4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one |
| PubChem CID | 53237455 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one |
| SMILES | COc1ccc([C@@H]2CNC(=O)C2)cc1OC |
| InChI | InChI=1S/C12H15NO3/c1-15-10-4-3-8(5-11(10)16-2)9-6-12(14)13-7-9/h3-5,9H,6-7H2,1-2H3,(H,13,14)/t9-/m0/s1 |
| InChIKey | JNRKFSJWVCILHE-VIFPVBQESA-N |
| XLogP | 1.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one?
The IUPAC name of (4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one (CID 53237455) is (4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one.
What is the SMILES notation for (4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one?
The canonical SMILES for (4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one is COc1ccc([C@@H]2CNC(=O)C2)cc1OC.
What is the InChIKey of (4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one?
The InChIKey is JNRKFSJWVCILHE-VIFPVBQESA-N. The full InChI is InChI=1S/C12H15NO3/c1-15-10-4-3-8(5-11(10)16-2)9-6-12(14)13-7-9/h3-5,9H,6-7H2,1-2H3,(H,13,14)/t9-/m0/s1.
What are the key properties of (4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one?
(4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one has a molecular weight of 221.26 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one is sourced from PubChem (CID 53237455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).