C10H6N2OS — CID 5323778
9-oxa-2-thia-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene (PubChem CID 5323778) has the molecular formula C10H6N2OS and a molecular weight of 202.24 g/mol. Its IUPAC name is 9-oxa-2-thia-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene.
| Compound Name | 9-oxa-2-thia-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
|---|---|
| PubChem CID | 5323778 |
| Molecular Formula | C10H6N2OS |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 9-oxa-2-thia-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
| SMILES | c1cnc2c(c1)Oc1cccnc1S2 |
| InChI | InChI=1S/C10H6N2OS/c1-3-7-9(11-5-1)14-10-8(13-7)4-2-6-12-10/h1-6H |
| InChIKey | SMAIHLPDIYOZHT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |