About N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine
N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine (PubChem CID 53237819) has the molecular formula C11H15NOS
and a molecular weight of 209.31 g/mol. Its IUPAC name is N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine.
Molecular Properties
| Compound Name | N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine |
| PubChem CID | 53237819 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine |
| SMILES | c1cc2c(s1)CCOC2CNC1CC1 |
| InChI | InChI=1S/C11H15NOS/c1-2-8(1)12-7-10-9-4-6-14-11(9)3-5-13-10/h4,6,8,10,12H,1-3,5,7H2 |
| InChIKey | ARVIBMQBZQVIHJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine?
The IUPAC name of N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine (CID 53237819) is N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine.
What is the SMILES notation for N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine?
The canonical SMILES for N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine is c1cc2c(s1)CCOC2CNC1CC1.
What is the InChIKey of N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine?
The InChIKey is ARVIBMQBZQVIHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NOS/c1-2-8(1)12-7-10-9-4-6-14-11(9)3-5-13-10/h4,6,8,10,12H,1-3,5,7H2.
What are the key properties of N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine?
N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine has a molecular weight of 209.31 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)cyclopropanamine is sourced from PubChem (CID 53237819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).