About N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide
N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide (PubChem CID 53237928) has the molecular formula C14H24N2O5
and a molecular weight of 300.36 g/mol. Its IUPAC name is N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide.
Molecular Properties
| Compound Name | N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide |
| PubChem CID | 53237928 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide |
| SMILES | CCCCOCCCNC(=O)CC(=O)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C14H24N2O5/c1-2-3-7-20-8-4-6-15-12(17)10-13(18)16-11-5-9-21-14(11)19/h11H,2-10H2,1H3,(H,15,17)(H,16,18)/t11-/m0/s1 |
| InChIKey | ABJWTJLWVOXLNV-NSHDSACASA-N |
| XLogP | 0.13 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide?
The IUPAC name of N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide (CID 53237928) is N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide.
What is the SMILES notation for N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide?
The canonical SMILES for N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide is CCCCOCCCNC(=O)CC(=O)N[C@H]1CCOC1=O.
What is the InChIKey of N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide?
The InChIKey is ABJWTJLWVOXLNV-NSHDSACASA-N. The full InChI is InChI=1S/C14H24N2O5/c1-2-3-7-20-8-4-6-15-12(17)10-13(18)16-11-5-9-21-14(11)19/h11H,2-10H2,1H3,(H,15,17)(H,16,18)/t11-/m0/s1.
What are the key properties of N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide?
N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide has a molecular weight of 300.36 g/mol, XLogP of 0.13, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-butoxypropyl)-N'-[(3S)-2-oxooxolan-3-yl]propanediamide is sourced from PubChem (CID 53237928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).