About (2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine
(2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine (PubChem CID 53238044) has the molecular formula C8H10FNOS
and a molecular weight of 187.24 g/mol. Its IUPAC name is (2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine.
Molecular Properties
| Compound Name | (2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine |
| PubChem CID | 53238044 |
| Molecular Formula | C8H10FNOS |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | (2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine |
| SMILES | NCC1OCCc2sc(F)cc21 |
| InChI | InChI=1S/C8H10FNOS/c9-8-3-5-6(4-10)11-2-1-7(5)12-8/h3,6H,1-2,4,10H2 |
| InChIKey | SAADYZLXEVGUKG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine?
The IUPAC name of (2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine (CID 53238044) is (2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine.
What is the SMILES notation for (2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine?
The canonical SMILES for (2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine is NCC1OCCc2sc(F)cc21.
What is the InChIKey of (2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine?
The InChIKey is SAADYZLXEVGUKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNOS/c9-8-3-5-6(4-10)11-2-1-7(5)12-8/h3,6H,1-2,4,10H2.
What are the key properties of (2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine?
(2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine has a molecular weight of 187.24 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methanamine is sourced from PubChem (CID 53238044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).