C20H22F3NO5S — CID 53238349
ethyl 5-[5-amino-2-(trifluoromethylsulfonyloxy)phenyl]-2-phenylpentanoate (PubChem CID 53238349) has the molecular formula C20H22F3NO5S and a molecular weight of 445.46 g/mol. Its IUPAC name is ethyl 5-[5-amino-2-(trifluoromethylsulfonyloxy)phenyl]-2-phenylpentanoate.
| Compound Name | ethyl 5-[5-amino-2-(trifluoromethylsulfonyloxy)phenyl]-2-phenylpentanoate |
|---|---|
| PubChem CID | 53238349 |
| Molecular Formula | C20H22F3NO5S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | ethyl 5-[5-amino-2-(trifluoromethylsulfonyloxy)phenyl]-2-phenylpentanoate |
| SMILES | CCOC(=O)C(CCCc1cc(N)ccc1OS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C20H22F3NO5S/c1-2-28-19(25)17(14-7-4-3-5-8-14)10-6-9-15-13-16(24)11-12-18(15)29-30(26,27)20(21,22)23/h3-5,7-8,11-13,17H,2,6,9-10,24H2,1H3 |
| InChIKey | WSHFELKLJPLBJG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|