C19H21NO2 — CID 53238351
ethyl 4-(4-aminophenyl)-1,2,3,4-tetrahydronaphthalene-1-carboxylate (PubChem CID 53238351) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is ethyl 4-(4-aminophenyl)-1,2,3,4-tetrahydronaphthalene-1-carboxylate.
| Compound Name | ethyl 4-(4-aminophenyl)-1,2,3,4-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 53238351 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | ethyl 4-(4-aminophenyl)-1,2,3,4-tetrahydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(c2ccc(N)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H21NO2/c1-2-22-19(21)18-12-11-15(13-7-9-14(20)10-8-13)16-5-3-4-6-17(16)18/h3-10,15,18H,2,11-12,20H2,1H3 |
| InChIKey | SMCOHZPQPQVAOF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|