C14H11ClN2O3S — CID 53238370
2-(5-chloro-2-pyridinyl)-5-ethylsulfonyl-1,3-benzoxazole (PubChem CID 53238370) has the molecular formula C14H11ClN2O3S and a molecular weight of 322.77 g/mol. Its IUPAC name is 2-(5-chloro-2-pyridinyl)-5-ethylsulfonyl-1,3-benzoxazole.
| Compound Name | 2-(5-chloro-2-pyridinyl)-5-ethylsulfonyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 53238370 |
| Molecular Formula | C14H11ClN2O3S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 2-(5-chloro-2-pyridinyl)-5-ethylsulfonyl-1,3-benzoxazole |
| SMILES | CCS(=O)(=O)c1ccc2oc(-c3ccc(Cl)cn3)nc2c1 |
| InChI | InChI=1S/C14H11ClN2O3S/c1-2-21(18,19)10-4-6-13-12(7-10)17-14(20-13)11-5-3-9(15)8-16-11/h3-8H,2H2,1H3 |
| InChIKey | VLLNORRHANBPIY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |