C11H15NOS — CID 53238518
spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] (PubChem CID 53238518) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine].
| Compound Name | spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
|---|---|
| PubChem CID | 53238518 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
| SMILES | c1cc2c(s1)CCOC21CCNCC1 |
| InChI | InChI=1S/C11H15NOS/c1-7-13-11(3-5-12-6-4-11)9-2-8-14-10(1)9/h2,8,12H,1,3-7H2 |
| InChIKey | KARGZLCFESUWBW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |