C18H25Br2N5OSi — CID 53238799
4-[4,5-dibromo-1-(2-trimethylsilylethoxymethyl)pyrrol-2-yl]-N,N-dimethyl-1H-imidazo[4,5-c]pyridin-2-amine (PubChem CID 53238799) has the molecular formula C18H25Br2N5OSi and a molecular weight of 515.33 g/mol. Its IUPAC name is 4-[4,5-dibromo-1-(2-trimethylsilylethoxymethyl)pyrrol-2-yl]-N,N-dimethyl-1H-imidazo[4,5-c]pyridin-2-amine.
| Compound Name | 4-[4,5-dibromo-1-(2-trimethylsilylethoxymethyl)pyrrol-2-yl]-N,N-dimethyl-1H-imidazo[4,5-c]pyridin-2-amine |
|---|---|
| PubChem CID | 53238799 |
| Molecular Formula | C18H25Br2N5OSi |
| Molecular Weight | 515.33 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | 4-[4,5-dibromo-1-(2-trimethylsilylethoxymethyl)pyrrol-2-yl]-N,N-dimethyl-1H-imidazo[4,5-c]pyridin-2-amine |
| SMILES | CN(C)c1nc2c(-c3cc(Br)c(Br)n3COCC[Si](C)(C)C)nccc2[nH]1 |
| InChI | InChI=1S/C18H25Br2N5OSi/c1-24(2)18-22-13-6-7-21-16(15(13)23-18)14-10-12(19)17(20)25(14)11-26-8-9-27(3,4)5/h6-7,10H,8-9,11H2,1-5H3,(H,22,23) |
| InChIKey | BLICEVKVOVTSLN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.33 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|