About N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide
N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide (PubChem CID 53238846) has the molecular formula C17H32N2O3
and a molecular weight of 312.45 g/mol. Its IUPAC name is N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide.
Molecular Properties
| Compound Name | N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide |
| PubChem CID | 53238846 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide |
| SMILES | CCCCCCCCNC(=O)CC(=O)N[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C17H32N2O3/c1-2-3-4-5-6-9-12-18-16(21)13-17(22)19-14-10-7-8-11-15(14)20/h14-15,20H,2-13H2,1H3,(H,18,21)(H,19,22)/t14-,15+/m1/s1 |
| InChIKey | LSQQRSJCZUFJEY-CABCVRRESA-N |
| XLogP | 2.27 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide?
The IUPAC name of N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide (CID 53238846) is N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide.
What is the SMILES notation for N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide?
The canonical SMILES for N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide is CCCCCCCCNC(=O)CC(=O)N[C@@H]1CCCC[C@@H]1O.
What is the InChIKey of N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide?
The InChIKey is LSQQRSJCZUFJEY-CABCVRRESA-N. The full InChI is InChI=1S/C17H32N2O3/c1-2-3-4-5-6-9-12-18-16(21)13-17(22)19-14-10-7-8-11-15(14)20/h14-15,20H,2-13H2,1H3,(H,18,21)(H,19,22)/t14-,15+/m1/s1.
What are the key properties of N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide?
N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide has a molecular weight of 312.45 g/mol, XLogP of 2.27, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(1R,2S)-2-hydroxycyclohexyl]-N-octylpropanediamide is sourced from PubChem (CID 53238846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).