C20H20O7 — CID 53239164
methyl (1R,2R,5S,8R,9S,10R,11S)-5-hydroxy-11-methyl-6-methylidene-7,12,16-trioxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate (PubChem CID 53239164) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is methyl (1R,2R,5S,8R,9S,10R,11S)-5-hydroxy-11-methyl-6-methylidene-7,12,16-trioxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate.
| Compound Name | methyl (1R,2R,5S,8R,9S,10R,11S)-5-hydroxy-11-methyl-6-methylidene-7,12,16-trioxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate |
|---|---|
| PubChem CID | 53239164 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | methyl (1R,2R,5S,8R,9S,10R,11S)-5-hydroxy-11-methyl-6-methylidene-7,12,16-trioxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate |
| SMILES | C=C1C(=O)[C@]23C[C@@]1(O)CC[C@H]2[C@@]12C=CC(=O)[C@@](C)(C(=O)O1)[C@H]2[C@@H]3C(=O)OC |
| InChI | InChI=1S/C20H20O7/c1-9-14(22)19-8-18(9,25)6-4-10(19)20-7-5-11(21)17(2,16(24)27-20)13(20)12(19)15(23)26-3/h5,7,10,12-13,25H,1,4,6,8H2,2-3H3/t10-,12-,13-,17-,18+,19-,20-/m1/s1 |
| InChIKey | OKDMSRHXSWADEP-FJXLXCJVSA-N |
| XLogP | 0.50 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|