C21H34BrN5O3Si — CID 53239246
tert-butyl N-[4-[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrol-2-yl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridin-2-yl]carbamate (PubChem CID 53239246) has the molecular formula C21H34BrN5O3Si and a molecular weight of 512.53 g/mol. Its IUPAC name is tert-butyl N-[4-[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrol-2-yl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridin-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrol-2-yl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridin-2-yl]carbamate |
|---|---|
| PubChem CID | 53239246 |
| Molecular Formula | C21H34BrN5O3Si |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | tert-butyl N-[4-[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrol-2-yl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc2c([nH]1)CCNC2c1cc(Br)cn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C21H34BrN5O3Si/c1-21(2,3)30-20(28)26-19-24-15-7-8-23-18(17(15)25-19)16-11-14(22)12-27(16)13-29-9-10-31(4,5)6/h11-12,18,23H,7-10,13H2,1-6H3,(H2,24,25,26,28) |
| InChIKey | NNPQWACYZOCDQV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|