About 1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea
1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea (PubChem CID 53239374) has the molecular formula C19H20N4O3
and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea.
Molecular Properties
| Compound Name | 1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea |
| PubChem CID | 53239374 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc2ncc(-c3ccc(OC)c(OC)c3)cc2n1 |
| InChI | InChI=1S/C19H20N4O3/c1-4-20-19(24)23-18-8-6-14-15(22-18)9-13(11-21-14)12-5-7-16(25-2)17(10-12)26-3/h5-11H,4H2,1-3H3,(H2,20,22,23,24) |
| InChIKey | WWUXHXQJFWXACS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea?
The IUPAC name of 1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea (CID 53239374) is 1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea.
What is the SMILES notation for 1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea?
The canonical SMILES for 1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea is CCNC(=O)Nc1ccc2ncc(-c3ccc(OC)c(OC)c3)cc2n1.
What is the InChIKey of 1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea?
The InChIKey is WWUXHXQJFWXACS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O3/c1-4-20-19(24)23-18-8-6-14-15(22-18)9-13(11-21-14)12-5-7-16(25-2)17(10-12)26-3/h5-11H,4H2,1-3H3,(H2,20,22,23,24).
What are the key properties of 1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea?
1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea has a molecular weight of 352.39 g/mol, XLogP of 3.46, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]-3-ethylurea is sourced from PubChem (CID 53239374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).