About 1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea
1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea (PubChem CID 53239375) has the molecular formula C21H24N4O3
and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea.
Molecular Properties
| Compound Name | 1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea |
| PubChem CID | 53239375 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea |
| SMILES | COc1ccc(-c2cnc3ccc(NC(=O)NC(C)(C)C)nc3c2)cc1OC |
| InChI | InChI=1S/C21H24N4O3/c1-21(2,3)25-20(26)24-19-9-7-15-16(23-19)10-14(12-22-15)13-6-8-17(27-4)18(11-13)28-5/h6-12H,1-5H3,(H2,23,24,25,26) |
| InChIKey | OUBLXGAHJPBMHW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea?
The IUPAC name of 1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea (CID 53239375) is 1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea.
What is the SMILES notation for 1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea?
The canonical SMILES for 1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea is COc1ccc(-c2cnc3ccc(NC(=O)NC(C)(C)C)nc3c2)cc1OC.
What is the InChIKey of 1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea?
The InChIKey is OUBLXGAHJPBMHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O3/c1-21(2,3)25-20(26)24-19-9-7-15-16(23-19)10-14(12-22-15)13-6-8-17(27-4)18(11-13)28-5/h6-12H,1-5H3,(H2,23,24,25,26).
What are the key properties of 1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea?
1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea has a molecular weight of 380.45 g/mol, XLogP of 4.23, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-[7-(3,4-dimethoxyphenyl)-1,5-naphthyridin-2-yl]urea is sourced from PubChem (CID 53239375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).