C27H27N7S — CID 53239537
2-N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-quinolin-3-ylthieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 53239537) has the molecular formula C27H27N7S and a molecular weight of 481.63 g/mol. Its IUPAC name is 2-N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-quinolin-3-ylthieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-quinolin-3-ylthieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 53239537 |
| Molecular Formula | C27H27N7S |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 2-N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-quinolin-3-ylthieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCN1CCN(c2ccc(Nc3nc(N)c4scc(-c5cnc6ccccc6c5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C27H27N7S/c1-2-33-11-13-34(14-12-33)21-9-7-20(8-10-21)30-27-31-24-22(17-35-25(24)26(28)32-27)19-15-18-5-3-4-6-23(18)29-16-19/h3-10,15-17H,2,11-14H2,1H3,(H3,28,30,31,32) |
| InChIKey | ASOQVCNSDQLKCI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|